About 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile
2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile (PubChem CID 141138783) has the molecular formula C14H17N2OP
and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile |
| PubChem CID | 141138783 |
| Molecular Formula | C14H17N2OP |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile |
| SMILES | CCP(=O)(CC)Cc1cc(C#N)c(C)cc1C#N |
| InChI | InChI=1S/C14H17N2OP/c1-4-18(17,5-2)10-14-7-12(8-15)11(3)6-13(14)9-16/h6-7H,4-5,10H2,1-3H3 |
| InChIKey | CQASPLPLRCJLRC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile?
The IUPAC name of 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile (CID 141138783) is 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile.
What is the SMILES notation for 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile?
The canonical SMILES for 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile is CCP(=O)(CC)Cc1cc(C#N)c(C)cc1C#N.
What is the InChIKey of 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile?
The InChIKey is CQASPLPLRCJLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N2OP/c1-4-18(17,5-2)10-14-7-12(8-15)11(3)6-13(14)9-16/h6-7H,4-5,10H2,1-3H3.
What are the key properties of 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile?
2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile has a molecular weight of 260.28 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylphosphorylmethyl)-5-methylbenzene-1,4-dicarbonitrile is sourced from PubChem (CID 141138783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).