C11H22O3Si — CID 141139006
6-trimethylsilyloxyoctane-3,5-dione (PubChem CID 141139006) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is 6-trimethylsilyloxyoctane-3,5-dione.
| Compound Name | 6-trimethylsilyloxyoctane-3,5-dione |
|---|---|
| PubChem CID | 141139006 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 6-trimethylsilyloxyoctane-3,5-dione |
| SMILES | CCC(=O)CC(=O)C(CC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-6-9(12)8-10(13)11(7-2)14-15(3,4)5/h11H,6-8H2,1-5H3 |
| InChIKey | UZTKEDFSHYALEH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|