C12H23N3S — CID 141139303
(2S)-1-(1-hexylimidazol-2-yl)sulfanylpropan-2-amine (PubChem CID 141139303) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is (2S)-1-(1-hexylimidazol-2-yl)sulfanylpropan-2-amine.
| Compound Name | (2S)-1-(1-hexylimidazol-2-yl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 141139303 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2S)-1-(1-hexylimidazol-2-yl)sulfanylpropan-2-amine |
| SMILES | CCCCCCn1ccnc1SC[C@H](C)N |
| InChI | InChI=1S/C12H23N3S/c1-3-4-5-6-8-15-9-7-14-12(15)16-10-11(2)13/h7,9,11H,3-6,8,10,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | GHDMEWJRSWESRG-NSHDSACASA-N |
| XLogP | 2.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|