About imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride
imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride (PubChem CID 141139843) has the molecular formula C12H11Cl2N3O
and a molecular weight of 284.15 g/mol. Its IUPAC name is imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride |
| PubChem CID | 141139843 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ncn2c1ccc1ccccc12 |
| InChI | InChI=1S/C12H9N3O.2ClH/c13-12(16)11-10-6-5-8-3-1-2-4-9(8)15(10)7-14-11;;/h1-7H,(H2,13,16);2*1H |
| InChIKey | VFIVKSSAYDKVDI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride?
The IUPAC name of imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride (CID 141139843) is imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride.
What is the SMILES notation for imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride?
The canonical SMILES for imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride is Cl.Cl.NC(=O)c1ncn2c1ccc1ccccc12.
What is the InChIKey of imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride?
The InChIKey is VFIVKSSAYDKVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O.2ClH/c13-12(16)11-10-6-5-8-3-1-2-4-9(8)15(10)7-14-11;;/h1-7H,(H2,13,16);2*1H.
What are the key properties of imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride?
imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride has a molecular weight of 284.15 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,5-a]quinoline-3-carboxamide;dihydrochloride is sourced from PubChem (CID 141139843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).