About 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one
3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one (PubChem CID 141139932) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one.
Analyze 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one (CID 141139932) is 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one is CC1COC(N2CCOC2=O)O1.
What is the InChIKey of 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one?
The InChIKey is ZPFPDDBIBZRGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-5-4-11-7(12-5)8-2-3-10-6(8)9/h5,7H,2-4H2,1H3.
What are the key properties of 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one?
3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one has a molecular weight of 173.17 g/mol, XLogP of 0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,3-dioxolan-2-yl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 141139932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).