C10H14O4 — CID 141140993
3,4,5-trimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 141140993) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,4,5-trimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 3,4,5-trimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 141140993 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3,4,5-trimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | COC1=CC2(C)OC2C(OC)=C1OC |
| InChI | InChI=1S/C10H14O4/c1-10-5-6(11-2)7(12-3)8(13-4)9(10)14-10/h5,9H,1-4H3 |
| InChIKey | XMZSZZVCSSFYMW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|