About piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone
piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone (PubChem CID 141141123) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone.
Molecular Properties
| Compound Name | piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone |
| PubChem CID | 141141123 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone |
| SMILES | O=C(C1CCC(n2cnnc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C14H22N4O/c19-14(17-8-2-1-3-9-17)12-4-6-13(7-5-12)18-10-15-16-11-18/h10-13H,1-9H2 |
| InChIKey | VFGQGQBKROMDKS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone?
The IUPAC name of piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone (CID 141141123) is piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone.
What is the SMILES notation for piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone?
The canonical SMILES for piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone is O=C(C1CCC(n2cnnc2)CC1)N1CCCCC1.
What is the InChIKey of piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone?
The InChIKey is VFGQGQBKROMDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c19-14(17-8-2-1-3-9-17)12-4-6-13(7-5-12)18-10-15-16-11-18/h10-13H,1-9H2.
What are the key properties of piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone?
piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone has a molecular weight of 262.36 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl-[4-(1,2,4-triazol-4-yl)cyclohexyl]methanone is sourced from PubChem (CID 141141123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).