C15H11ClN4O3S — CID 141141160
4-chloro-2-(quinoxalin-5-ylsulfonylamino)benzamide (PubChem CID 141141160) has the molecular formula C15H11ClN4O3S and a molecular weight of 362.80 g/mol. Its IUPAC name is 4-chloro-2-(quinoxalin-5-ylsulfonylamino)benzamide.
| Compound Name | 4-chloro-2-(quinoxalin-5-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 141141160 |
| Molecular Formula | C15H11ClN4O3S |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-chloro-2-(quinoxalin-5-ylsulfonylamino)benzamide |
| SMILES | NC(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H11ClN4O3S/c16-9-4-5-10(15(17)21)12(8-9)20-24(22,23)13-3-1-2-11-14(13)19-7-6-18-11/h1-8,20H,(H2,17,21) |
| InChIKey | LLLXMXPDSMFBMJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |