About bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane
bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane (PubChem CID 141141610) has the molecular formula C9H13PS3
and a molecular weight of 248.38 g/mol. Its IUPAC name is bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane.
Molecular Properties
| Compound Name | bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane |
| PubChem CID | 141141610 |
| Molecular Formula | C9H13PS3 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane |
| SMILES | Cc1ccc(SP(S)S)c(C)c1C |
| InChI | InChI=1S/C9H13PS3/c1-6-4-5-9(13-10(11)12)8(3)7(6)2/h4-5,11-12H,1-3H3 |
| InChIKey | UQGAUTJDOJVNJH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane?
The IUPAC name of bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane (CID 141141610) is bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane.
What is the SMILES notation for bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane?
The canonical SMILES for bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane is Cc1ccc(SP(S)S)c(C)c1C.
What is the InChIKey of bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane?
The InChIKey is UQGAUTJDOJVNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13PS3/c1-6-4-5-9(13-10(11)12)8(3)7(6)2/h4-5,11-12H,1-3H3.
What are the key properties of bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane?
bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane has a molecular weight of 248.38 g/mol, XLogP of 4.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(sulfanyl)-(2,3,4-trimethylphenyl)sulfanylphosphane is sourced from PubChem (CID 141141610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).