C14H21N5 — CID 141141816
2-[[4-(aminomethyl)phenyl]methyl]-1-cyano-3-(2-methylpropyl)guanidine (PubChem CID 141141816) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]methyl]-1-cyano-3-(2-methylpropyl)guanidine.
| Compound Name | 2-[[4-(aminomethyl)phenyl]methyl]-1-cyano-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 141141816 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]methyl]-1-cyano-3-(2-methylpropyl)guanidine |
| SMILES | CC(C)CN/C(=N/Cc1ccc(CN)cc1)NC#N |
| InChI | InChI=1S/C14H21N5/c1-11(2)8-17-14(19-10-16)18-9-13-5-3-12(7-15)4-6-13/h3-6,11H,7-9,15H2,1-2H3,(H2,17,18,19) |
| InChIKey | VFJSFRKPSMBTKB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|