C11H24N4O2 — CID 141141833
N'-[2-nitro-1-(propylamino)ethenyl]hexane-1,6-diamine (PubChem CID 141141833) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-[2-nitro-1-(propylamino)ethenyl]hexane-1,6-diamine.
| Compound Name | N'-[2-nitro-1-(propylamino)ethenyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 141141833 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N'-[2-nitro-1-(propylamino)ethenyl]hexane-1,6-diamine |
| SMILES | CCCNC(=C[N+](=O)[O-])NCCCCCCN |
| InChI | InChI=1S/C11H24N4O2/c1-2-8-13-11(10-15(16)17)14-9-6-4-3-5-7-12/h10,13-14H,2-9,12H2,1H3 |
| InChIKey | JNVGVYAQVJLOIB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|