About 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one
3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one (PubChem CID 141142299) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one |
| PubChem CID | 141142299 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one |
| SMILES | COc1ccc(NC2=CC(=O)CC=C2)cc1OC |
| InChI | InChI=1S/C14H15NO3/c1-17-13-7-6-11(9-14(13)18-2)15-10-4-3-5-12(16)8-10/h3-4,6-9,15H,5H2,1-2H3 |
| InChIKey | XFDJWNHYCRYDOB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one?
The IUPAC name of 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one (CID 141142299) is 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one is COc1ccc(NC2=CC(=O)CC=C2)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one?
The InChIKey is XFDJWNHYCRYDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-17-13-7-6-11(9-14(13)18-2)15-10-4-3-5-12(16)8-10/h3-4,6-9,15H,5H2,1-2H3.
What are the key properties of 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one?
3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one has a molecular weight of 245.28 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyanilino)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 141142299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).