C11H17NO — CID 141142400
1-methyl-3-[(E)-pent-1-enyl]-2H-pyridin-5-ol (PubChem CID 141142400) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-methyl-3-[(E)-pent-1-enyl]-2H-pyridin-5-ol.
| Compound Name | 1-methyl-3-[(E)-pent-1-enyl]-2H-pyridin-5-ol |
|---|---|
| PubChem CID | 141142400 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-methyl-3-[(E)-pent-1-enyl]-2H-pyridin-5-ol |
| SMILES | CCC/C=C/C1=CC(O)=CN(C)C1 |
| InChI | InChI=1S/C11H17NO/c1-3-4-5-6-10-7-11(13)9-12(2)8-10/h5-7,9,13H,3-4,8H2,1-2H3/b6-5+ |
| InChIKey | AUQIXVJFZOQHMW-AATRIKPKSA-N |
| XLogP | 2.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |