C7H3Cl3O4S — CID 141142417
4,5,6-trichloro-3-sulfonylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 141142417) has the molecular formula C7H3Cl3O4S and a molecular weight of 289.52 g/mol. Its IUPAC name is 4,5,6-trichloro-3-sulfonylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4,5,6-trichloro-3-sulfonylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141142417 |
| Molecular Formula | C7H3Cl3O4S |
| Molecular Weight | 289.52 g/mol |
| Exact Mass | 287.88 |
| IUPAC Name | 4,5,6-trichloro-3-sulfonylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(=S(=O)=O)C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C7H3Cl3O4S/c8-4-2(7(11)12)1-3(15(13)14)5(9)6(4)10/h1,5H,(H,11,12) |
| InChIKey | IRHNJWFRBQRCPM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|