About (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol
(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol (PubChem CID 14114269) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol.
Molecular Properties
| Compound Name | (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
| PubChem CID | 14114269 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
| SMILES | CC1(CO)CCCc2ccccc21 |
| InChI | InChI=1S/C12H16O/c1-12(9-13)8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7,13H,4,6,8-9H2,1H3 |
| InChIKey | BVOXKRPQUJYDDZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol?
The IUPAC name of (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol (CID 14114269) is (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol.
What is the SMILES notation for (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol?
The canonical SMILES for (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol is CC1(CO)CCCc2ccccc21.
What is the InChIKey of (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol?
The InChIKey is BVOXKRPQUJYDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-12(9-13)8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7,13H,4,6,8-9H2,1H3.
What are the key properties of (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol?
(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol has a molecular weight of 176.26 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,4-dihydro-2H-naphthalen-1-yl)methanol is sourced from PubChem (CID 14114269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).