C19H27NO2S — CID 141142715
(1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-piperidin-2-ylpentan-1-ol (PubChem CID 141142715) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-piperidin-2-ylpentan-1-ol.
| Compound Name | (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-piperidin-2-ylpentan-1-ol |
|---|---|
| PubChem CID | 141142715 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-piperidin-2-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cc2ccccc2s1)C1CCCCN1 |
| InChI | InChI=1S/C19H27NO2S/c1-22-13-7-5-11-19(21,17-10-4-6-12-20-17)18-14-15-8-2-3-9-16(15)23-18/h2-3,8-9,14,17,20-21H,4-7,10-13H2,1H3/t17?,19-/m0/s1 |
| InChIKey | IJZYHNUIZQSMPK-NNBQYGFHSA-N |
| XLogP | 4.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|