C25H44O2 — CID 141142927
2-[(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10-trien-3-yl]oxyoxane (PubChem CID 141142927) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10-trien-3-yl]oxyoxane.
| Compound Name | 2-[(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10-trien-3-yl]oxyoxane |
|---|---|
| PubChem CID | 141142927 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 2-[(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10-trien-3-yl]oxyoxane |
| SMILES | C=CC(C)(CC/C=C(\C)CC/C=C(\C)CCCC(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C25H44O2/c1-7-25(6,27-24-18-8-9-20-26-24)19-12-17-23(5)16-11-15-22(4)14-10-13-21(2)3/h7,15,17,21,24H,1,8-14,16,18-20H2,2-6H3/b22-15+,23-17+ |
| InChIKey | WIRSMJSWNDAGSF-YYZDAUDSSA-N |
| XLogP | 7.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|