C13H15N3O — CID 141143468
5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 141143468) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 141143468 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3[nH]cnc3cc21 |
| InChI | InChI=1S/C13H15N3O/c1-4-16-11-6-10-9(14-7-15-10)5-8(11)13(2,3)12(16)17/h5-7H,4H2,1-3H3,(H,14,15) |
| InChIKey | QHFXCZXXHAQEIT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |