About 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one
3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one (PubChem CID 141144025) has the molecular formula C11H13NOS2
and a molecular weight of 239.37 g/mol. Its IUPAC name is 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one |
| PubChem CID | 141144025 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(S)N1CCc1ccccc1 |
| InChI | InChI=1S/C11H13NOS2/c13-10-8-15-11(14)12(10)7-6-9-4-2-1-3-5-9/h1-5,11,14H,6-8H2 |
| InChIKey | AOVJDIDARZDRJC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one (CID 141144025) is 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one is O=C1CSC(S)N1CCc1ccccc1.
What is the InChIKey of 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one?
The InChIKey is AOVJDIDARZDRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS2/c13-10-8-15-11(14)12(10)7-6-9-4-2-1-3-5-9/h1-5,11,14H,6-8H2.
What are the key properties of 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one?
3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one has a molecular weight of 239.37 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethyl)-2-sulfanyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 141144025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).