About octyl-oxo-phenoxytin
octyl-oxo-phenoxytin (PubChem CID 141144042) has the molecular formula C14H22O2Sn
and a molecular weight of 341.04 g/mol. Its IUPAC name is octyl-oxo-phenoxytin.
Molecular Properties
| Compound Name | octyl-oxo-phenoxytin |
| PubChem CID | 141144042 |
| Molecular Formula | C14H22O2Sn |
| Molecular Weight | 341.04 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | octyl-oxo-phenoxytin |
| SMILES | CCCCCCCC[Sn](=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H17.C6H6O.O.Sn/c1-3-5-7-8-6-4-2;7-6-4-2-1-3-5-6;;/h1,3-8H2,2H3;1-5,7H;;/q;;;+1/p-1 |
| InChIKey | OLQRQHBXPNTXIH-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.04 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl-oxo-phenoxytin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl-oxo-phenoxytin?
The IUPAC name of octyl-oxo-phenoxytin (CID 141144042) is octyl-oxo-phenoxytin.
What is the SMILES notation for octyl-oxo-phenoxytin?
The canonical SMILES for octyl-oxo-phenoxytin is CCCCCCCC[Sn](=O)Oc1ccccc1.
What is the InChIKey of octyl-oxo-phenoxytin?
The InChIKey is OLQRQHBXPNTXIH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17.C6H6O.O.Sn/c1-3-5-7-8-6-4-2;7-6-4-2-1-3-5-6;;/h1,3-8H2,2H3;1-5,7H;;/q;;;+1/p-1.
What are the key properties of octyl-oxo-phenoxytin?
octyl-oxo-phenoxytin has a molecular weight of 341.04 g/mol, XLogP of 4.34, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octyl-oxo-phenoxytin is sourced from PubChem (CID 141144042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).