About pyridine-2,3,4,5-tetracarbaldehyde
pyridine-2,3,4,5-tetracarbaldehyde (PubChem CID 141144412) has the molecular formula C9H5NO4
and a molecular weight of 191.14 g/mol. Its IUPAC name is pyridine-2,3,4,5-tetracarbaldehyde.
Molecular Properties
| Compound Name | pyridine-2,3,4,5-tetracarbaldehyde |
| PubChem CID | 141144412 |
| Molecular Formula | C9H5NO4 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | pyridine-2,3,4,5-tetracarbaldehyde |
| SMILES | O=Cc1cnc(C=O)c(C=O)c1C=O |
| InChI | InChI=1S/C9H5NO4/c11-2-6-1-10-9(5-14)8(4-13)7(6)3-12/h1-5H |
| InChIKey | WHVLPQIQJSZSTB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze pyridine-2,3,4,5-tetracarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,3,4,5-tetracarbaldehyde?
The IUPAC name of pyridine-2,3,4,5-tetracarbaldehyde (CID 141144412) is pyridine-2,3,4,5-tetracarbaldehyde.
What is the SMILES notation for pyridine-2,3,4,5-tetracarbaldehyde?
The canonical SMILES for pyridine-2,3,4,5-tetracarbaldehyde is O=Cc1cnc(C=O)c(C=O)c1C=O.
What is the InChIKey of pyridine-2,3,4,5-tetracarbaldehyde?
The InChIKey is WHVLPQIQJSZSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO4/c11-2-6-1-10-9(5-14)8(4-13)7(6)3-12/h1-5H.
What are the key properties of pyridine-2,3,4,5-tetracarbaldehyde?
pyridine-2,3,4,5-tetracarbaldehyde has a molecular weight of 191.14 g/mol, XLogP of 0.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,3,4,5-tetracarbaldehyde is sourced from PubChem (CID 141144412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).