About 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile
3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile (PubChem CID 141144595) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile |
| PubChem CID | 141144595 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile |
| SMILES | CC(O)N(c1ncc(C#N)nc1C#N)C(C)O |
| InChI | InChI=1S/C10H11N5O2/c1-6(16)15(7(2)17)10-9(4-12)14-8(3-11)5-13-10/h5-7,16-17H,1-2H3 |
| InChIKey | IIOMXUKAYKPQCR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile?
The IUPAC name of 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile (CID 141144595) is 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile.
What is the SMILES notation for 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile?
The canonical SMILES for 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile is CC(O)N(c1ncc(C#N)nc1C#N)C(C)O.
What is the InChIKey of 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile?
The InChIKey is IIOMXUKAYKPQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c1-6(16)15(7(2)17)10-9(4-12)14-8(3-11)5-13-10/h5-7,16-17H,1-2H3.
What are the key properties of 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile?
3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile has a molecular weight of 233.23 g/mol, XLogP of -0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(1-hydroxyethyl)amino]pyrazine-2,6-dicarbonitrile is sourced from PubChem (CID 141144595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).