C20H14ClFN4O — CID 141145307
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-fluoroquinazolin-4-amine (PubChem CID 141145307) has the molecular formula C20H14ClFN4O and a molecular weight of 380.81 g/mol. Its IUPAC name is N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-fluoroquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 141145307 |
| Molecular Formula | C20H14ClFN4O |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2c1 |
| InChI | InChI=1S/C20H14ClFN4O/c21-17-10-14(5-7-19(17)27-11-15-3-1-2-8-23-15)26-20-16-6-4-13(22)9-18(16)24-12-25-20/h1-10,12H,11H2,(H,24,25,26) |
| InChIKey | GKRZSDDRPGAGQF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |