About [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea
[4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea (PubChem CID 141145853) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea.
Molecular Properties
| Compound Name | [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea |
| PubChem CID | 141145853 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea |
| SMILES | Cc1cc(CC2CC2)cc(C)c1NC(N)=O |
| InChI | InChI=1S/C13H18N2O/c1-8-5-11(7-10-3-4-10)6-9(2)12(8)15-13(14)16/h5-6,10H,3-4,7H2,1-2H3,(H3,14,15,16) |
| InChIKey | YIYKBTIEJIMOAH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea?
The IUPAC name of [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea (CID 141145853) is [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea.
What is the SMILES notation for [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea?
The canonical SMILES for [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea is Cc1cc(CC2CC2)cc(C)c1NC(N)=O.
What is the InChIKey of [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea?
The InChIKey is YIYKBTIEJIMOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-8-5-11(7-10-3-4-10)6-9(2)12(8)15-13(14)16/h5-6,10H,3-4,7H2,1-2H3,(H3,14,15,16).
What are the key properties of [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea?
[4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea has a molecular weight of 218.30 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyclopropylmethyl)-2,6-dimethylphenyl]urea is sourced from PubChem (CID 141145853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).