C22H32N2O2S2 — CID 141146046
N',N'-bis[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]ethane-1,2-diamine (PubChem CID 141146046) has the molecular formula C22H32N2O2S2 and a molecular weight of 420.64 g/mol. Its IUPAC name is N',N'-bis[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-bis[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 141146046 |
| Molecular Formula | C22H32N2O2S2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N',N'-bis[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]ethane-1,2-diamine |
| SMILES | COc1ccc(CSCCN(CCN)CCSCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H32N2O2S2/c1-25-21-7-3-19(4-8-21)17-27-15-13-24(12-11-23)14-16-28-18-20-5-9-22(26-2)10-6-20/h3-10H,11-18,23H2,1-2H3 |
| InChIKey | GOVPPOSNPNYETR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|