About cyclohexa-2,4-diene-1,2-dicarbohydrazide
cyclohexa-2,4-diene-1,2-dicarbohydrazide (PubChem CID 141146166) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is cyclohexa-2,4-diene-1,2-dicarbohydrazide.
Molecular Properties
| Compound Name | cyclohexa-2,4-diene-1,2-dicarbohydrazide |
| PubChem CID | 141146166 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | cyclohexa-2,4-diene-1,2-dicarbohydrazide |
| SMILES | NNC(=O)C1=CC=CCC1C(=O)NN |
| InChI | InChI=1S/C8H12N4O2/c9-11-7(13)5-3-1-2-4-6(5)8(14)12-10/h1-3,6H,4,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | JWSRNPUGHVWDKC-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-diene-1,2-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-diene-1,2-dicarbohydrazide?
The IUPAC name of cyclohexa-2,4-diene-1,2-dicarbohydrazide (CID 141146166) is cyclohexa-2,4-diene-1,2-dicarbohydrazide.
What is the SMILES notation for cyclohexa-2,4-diene-1,2-dicarbohydrazide?
The canonical SMILES for cyclohexa-2,4-diene-1,2-dicarbohydrazide is NNC(=O)C1=CC=CCC1C(=O)NN.
What is the InChIKey of cyclohexa-2,4-diene-1,2-dicarbohydrazide?
The InChIKey is JWSRNPUGHVWDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c9-11-7(13)5-3-1-2-4-6(5)8(14)12-10/h1-3,6H,4,9-10H2,(H,11,13)(H,12,14).
What are the key properties of cyclohexa-2,4-diene-1,2-dicarbohydrazide?
cyclohexa-2,4-diene-1,2-dicarbohydrazide has a molecular weight of 196.21 g/mol, XLogP of -1.53, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-diene-1,2-dicarbohydrazide is sourced from PubChem (CID 141146166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).