C9H16Cl2N4O — CID 141146320
2-(1H-pyrrol-3-yl)piperazine-1-carboxamide;dihydrochloride (PubChem CID 141146320) has the molecular formula C9H16Cl2N4O and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-(1H-pyrrol-3-yl)piperazine-1-carboxamide;dihydrochloride.
| Compound Name | 2-(1H-pyrrol-3-yl)piperazine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 141146320 |
| Molecular Formula | C9H16Cl2N4O |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(1H-pyrrol-3-yl)piperazine-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)N1CCNCC1c1cc[nH]c1 |
| InChI | InChI=1S/C9H14N4O.2ClH/c10-9(14)13-4-3-12-6-8(13)7-1-2-11-5-7;;/h1-2,5,8,11-12H,3-4,6H2,(H2,10,14);2*1H |
| InChIKey | YYNITMCYKWITLL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |