C34H39N3O2 — CID 141146478
2-[4-cyclohexyl-2-[3-(dimethylamino)-4-phenylphenyl]indol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 141146478) has the molecular formula C34H39N3O2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 2-[4-cyclohexyl-2-[3-(dimethylamino)-4-phenylphenyl]indol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-cyclohexyl-2-[3-(dimethylamino)-4-phenylphenyl]indol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 141146478 |
| Molecular Formula | C34H39N3O2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[4-cyclohexyl-2-[3-(dimethylamino)-4-phenylphenyl]indol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | CN(C)c1cc(-c2cc3c(C4CCCCC4)cccc3n2CC(=O)N2CCOCC2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C34H39N3O2/c1-35(2)33-22-27(16-17-29(33)26-12-7-4-8-13-26)32-23-30-28(25-10-5-3-6-11-25)14-9-15-31(30)37(32)24-34(38)36-18-20-39-21-19-36/h4,7-9,12-17,22-23,25H,3,5-6,10-11,18-21,24H2,1-2H3 |
| InChIKey | DJJWSCBPMKGRHK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |