About 2-[bis(phenylselanyl)methylidene]-1,3-diselenole
2-[bis(phenylselanyl)methylidene]-1,3-diselenole (PubChem CID 14114702) has the molecular formula C16H12Se4
and a molecular weight of 520.11 g/mol. Its IUPAC name is 2-[bis(phenylselanyl)methylidene]-1,3-diselenole.
Molecular Properties
| Compound Name | 2-[bis(phenylselanyl)methylidene]-1,3-diselenole |
| PubChem CID | 14114702 |
| Molecular Formula | C16H12Se4 |
| Molecular Weight | 520.11 g/mol |
| Exact Mass | 523.76 |
| IUPAC Name | 2-[bis(phenylselanyl)methylidene]-1,3-diselenole |
| SMILES | C1=C[Se]C(=C([Se]c2ccccc2)[Se]c2ccccc2)[Se]1 |
| InChI | InChI=1S/C16H12Se4/c1-3-7-13(8-4-1)19-16(15-17-11-12-18-15)20-14-9-5-2-6-10-14/h1-12H |
| InChIKey | JWKXEENAUKJWSR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.11 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(phenylselanyl)methylidene]-1,3-diselenole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(phenylselanyl)methylidene]-1,3-diselenole?
The IUPAC name of 2-[bis(phenylselanyl)methylidene]-1,3-diselenole (CID 14114702) is 2-[bis(phenylselanyl)methylidene]-1,3-diselenole.
What is the SMILES notation for 2-[bis(phenylselanyl)methylidene]-1,3-diselenole?
The canonical SMILES for 2-[bis(phenylselanyl)methylidene]-1,3-diselenole is C1=C[Se]C(=C([Se]c2ccccc2)[Se]c2ccccc2)[Se]1.
What is the InChIKey of 2-[bis(phenylselanyl)methylidene]-1,3-diselenole?
The InChIKey is JWKXEENAUKJWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Se4/c1-3-7-13(8-4-1)19-16(15-17-11-12-18-15)20-14-9-5-2-6-10-14/h1-12H.
What are the key properties of 2-[bis(phenylselanyl)methylidene]-1,3-diselenole?
2-[bis(phenylselanyl)methylidene]-1,3-diselenole has a molecular weight of 520.11 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(phenylselanyl)methylidene]-1,3-diselenole is sourced from PubChem (CID 14114702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).