About 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid
2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 141147103) has the molecular formula C12H15N5O2S
and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 141147103 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCNc1cc(Nc2ncc(C(=O)O)s2)nc(C)n1 |
| InChI | InChI=1S/C12H15N5O2S/c1-3-4-13-9-5-10(16-7(2)15-9)17-12-14-6-8(20-12)11(18)19/h5-6H,3-4H2,1-2H3,(H,18,19)(H2,13,14,15,16,17) |
| InChIKey | SZWWPSRSQRWRFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid (CID 141147103) is 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid is CCCNc1cc(Nc2ncc(C(=O)O)s2)nc(C)n1.
What is the InChIKey of 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is SZWWPSRSQRWRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O2S/c1-3-4-13-9-5-10(16-7(2)15-9)17-12-14-6-8(20-12)11(18)19/h5-6H,3-4H2,1-2H3,(H,18,19)(H2,13,14,15,16,17).
What are the key properties of 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid?
2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 293.35 g/mol, XLogP of 2.51, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 141147103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).