About 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide
3,4-bis(sulfanyl)benzene-1,2-dicarboxamide (PubChem CID 141147444) has the molecular formula C8H8N2O2S2
and a molecular weight of 228.30 g/mol. Its IUPAC name is 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide |
| PubChem CID | 141147444 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc(S)c(S)c1C(N)=O |
| InChI | InChI=1S/C8H8N2O2S2/c9-7(11)3-1-2-4(13)6(14)5(3)8(10)12/h1-2,13-14H,(H2,9,11)(H2,10,12) |
| InChIKey | YPAHRRQUIJJCSS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide?
The IUPAC name of 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide (CID 141147444) is 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide.
What is the SMILES notation for 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide?
The canonical SMILES for 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide is NC(=O)c1ccc(S)c(S)c1C(N)=O.
What is the InChIKey of 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide?
The InChIKey is YPAHRRQUIJJCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S2/c9-7(11)3-1-2-4(13)6(14)5(3)8(10)12/h1-2,13-14H,(H2,9,11)(H2,10,12).
What are the key properties of 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide?
3,4-bis(sulfanyl)benzene-1,2-dicarboxamide has a molecular weight of 228.30 g/mol, XLogP of 0.46, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(sulfanyl)benzene-1,2-dicarboxamide is sourced from PubChem (CID 141147444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).