About 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol
2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol (PubChem CID 141148291) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol |
| PubChem CID | 141148291 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol |
| SMILES | Cc1c2c(cc3c4cc(O)ccc4n(C)c13)CN(CCN(C)C)C=C2 |
| InChI | InChI=1S/C21H25N3O/c1-14-17-7-8-24(10-9-22(2)3)13-15(17)11-19-18-12-16(25)5-6-20(18)23(4)21(14)19/h5-8,11-12,25H,9-10,13H2,1-4H3 |
| InChIKey | LJOUUODFMGEAFU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol?
The IUPAC name of 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol (CID 141148291) is 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol.
What is the SMILES notation for 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol?
The canonical SMILES for 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol is Cc1c2c(cc3c4cc(O)ccc4n(C)c13)CN(CCN(C)C)C=C2.
What is the InChIKey of 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol?
The InChIKey is LJOUUODFMGEAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-14-17-7-8-24(10-9-22(2)3)13-15(17)11-19-18-12-16(25)5-6-20(18)23(4)21(14)19/h5-8,11-12,25H,9-10,13H2,1-4H3.
What are the key properties of 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol?
2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol has a molecular weight of 335.45 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol is sourced from PubChem (CID 141148291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).