C21H25N3O — CID 141148291
2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol (PubChem CID 141148291) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol.
| Compound Name | 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol |
|---|---|
| PubChem CID | 141148291 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5,6-dimethyl-1H-pyrido[4,3-b]carbazol-9-ol |
| SMILES | Cc1c2c(cc3c4cc(O)ccc4n(C)c13)CN(CCN(C)C)C=C2 |
| InChI | InChI=1S/C21H25N3O/c1-14-17-7-8-24(10-9-22(2)3)13-15(17)11-19-18-12-16(25)5-6-20(18)23(4)21(14)19/h5-8,11-12,25H,9-10,13H2,1-4H3 |
| InChIKey | LJOUUODFMGEAFU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|