C13H18N4O — CID 141148650
N-carbamimidoyl-N-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide (PubChem CID 141148650) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is N-carbamimidoyl-N-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide.
| Compound Name | N-carbamimidoyl-N-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141148650 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-carbamimidoyl-N-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cnc2c(c1)CCCCC2 |
| InChI | InChI=1S/C13H18N4O/c1-17(13(14)15)12(18)10-7-9-5-3-2-4-6-11(9)16-8-10/h7-8H,2-6H2,1H3,(H3,14,15) |
| InChIKey | YQYZGYUEIPHSDW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|