C29H50O — CID 141148812
(3S,8S,9S,10R,13R,14S,17R)-6,7,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 141148812) has the molecular formula C29H50O and a molecular weight of 414.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-6,7,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-6,7,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 141148812 |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.39 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-6,7,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(C)[C@H]2[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@H](O)CC12 |
| InChI | InChI=1S/C29H50O/c1-18(2)9-8-10-19(3)23-11-12-24-27-21(5)20(4)26-17-22(30)13-15-29(26,7)25(27)14-16-28(23,24)6/h18-19,22-27,30H,8-17H2,1-7H3/t19-,22+,23-,24+,25+,26?,27+,28-,29-/m1/s1 |
| InChIKey | PXUYTWIRPPMBSF-TYVHRCFHSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|