C11H17F2NO2S — CID 141149021
2,2-difluoro-3-[[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]propane-1-sulfinic acid (PubChem CID 141149021) has the molecular formula C11H17F2NO2S and a molecular weight of 265.32 g/mol. Its IUPAC name is 2,2-difluoro-3-[[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]propane-1-sulfinic acid.
| Compound Name | 2,2-difluoro-3-[[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 141149021 |
| Molecular Formula | C11H17F2NO2S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2,2-difluoro-3-[[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methylamino]propane-1-sulfinic acid |
| SMILES | C[C@]1(CNCC(F)(F)CS(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C11H17F2NO2S/c1-10(5-3-2-4-6-10)7-14-8-11(12,13)9-17(15)16/h2-5,14H,6-9H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | CDJGXHMOHNFOAC-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|