C15H6F13NO — CID 14114910
1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2H-isoquinolin-3-one (PubChem CID 14114910) has the molecular formula C15H6F13NO and a molecular weight of 463.19 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2H-isoquinolin-3-one.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 14114910 |
| Molecular Formula | C15H6F13NO |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2H-isoquinolin-3-one |
| SMILES | O=c1cc2ccccc2c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C15H6F13NO/c16-10(17,9-7-4-2-1-3-6(7)5-8(30)29-9)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1-5H,(H,29,30) |
| InChIKey | WSLBHKRPNHFYBO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|