C17H22N2O3 — CID 141149868
7-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethoxy]-2H-isoquinolin-1-one (PubChem CID 141149868) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 7-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethoxy]-2H-isoquinolin-1-one.
| Compound Name | 7-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethoxy]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 141149868 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 7-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethoxy]-2H-isoquinolin-1-one |
| SMILES | C[C@@H]1CN(CCOc2ccc3cc[nH]c(=O)c3c2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H22N2O3/c1-12-10-19(11-13(2)22-12)7-8-21-15-4-3-14-5-6-18-17(20)16(14)9-15/h3-6,9,12-13H,7-8,10-11H2,1-2H3,(H,18,20)/t12-,13+ |
| InChIKey | UHSACRNJGBKINF-BETUJISGSA-N |
| XLogP | 2.02 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |