C15H12ClF3IN3 — CID 141150787
N-[4-chloro-3-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-amine;hydroiodide (PubChem CID 141150787) has the molecular formula C15H12ClF3IN3 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-amine;hydroiodide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 141150787 |
| Molecular Formula | C15H12ClF3IN3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-amine;hydroiodide |
| SMILES | FC(F)(F)c1cc(NC2=NCc3ccccc3N2)ccc1Cl.I |
| InChI | InChI=1S/C15H11ClF3N3.HI/c16-12-6-5-10(7-11(12)15(17,18)19)21-14-20-8-9-3-1-2-4-13(9)22-14;/h1-7H,8H2,(H2,20,21,22);1H |
| InChIKey | QSMKBIWZBNCODX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|