About N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide
N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide (PubChem CID 141150963) has the molecular formula C11H11N5O3S
and a molecular weight of 293.31 g/mol. Its IUPAC name is N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide |
| PubChem CID | 141150963 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccc3oc(N)nc3c2)c1 |
| InChI | InChI=1S/C11H11N5O3S/c1-16-5-10(13-6-16)20(17,18)15-7-2-3-9-8(4-7)14-11(12)19-9/h2-6,15H,1H3,(H2,12,14) |
| InChIKey | CDOQQPPBBSOTQZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide?
The IUPAC name of N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide (CID 141150963) is N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide?
The canonical SMILES for N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide is Cn1cnc(S(=O)(=O)Nc2ccc3oc(N)nc3c2)c1.
What is the InChIKey of N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide?
The InChIKey is CDOQQPPBBSOTQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O3S/c1-16-5-10(13-6-16)20(17,18)15-7-2-3-9-8(4-7)14-11(12)19-9/h2-6,15H,1H3,(H2,12,14).
What are the key properties of N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide?
N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide has a molecular weight of 293.31 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-1,3-benzoxazol-5-yl)-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 141150963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).