C15H11N3O5 — CID 141151082
2,3-bis(4-nitrophenyl)prop-2-enamide (PubChem CID 141151082) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is 2,3-bis(4-nitrophenyl)prop-2-enamide.
| Compound Name | 2,3-bis(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 141151082 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2,3-bis(4-nitrophenyl)prop-2-enamide |
| SMILES | NC(=O)C(=Cc1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O5/c16-15(19)14(11-3-7-13(8-4-11)18(22)23)9-10-1-5-12(6-2-10)17(20)21/h1-9H,(H2,16,19) |
| InChIKey | OIZVYRCRVWYQNF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|