C25H21F3N2O4 — CID 141151420
ethyl 2-[1-(5-methoxy-2-pyridinyl)-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate (PubChem CID 141151420) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is ethyl 2-[1-(5-methoxy-2-pyridinyl)-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate.
| Compound Name | ethyl 2-[1-(5-methoxy-2-pyridinyl)-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate |
|---|---|
| PubChem CID | 141151420 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | ethyl 2-[1-(5-methoxy-2-pyridinyl)-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc2cc(Oc3ccc(C(F)(F)F)cc3)ccc2n1-c1ccc(OC)cn1 |
| InChI | InChI=1S/C25H21F3N2O4/c1-3-33-24(31)14-18-12-16-13-20(34-19-6-4-17(5-7-19)25(26,27)28)8-10-22(16)30(18)23-11-9-21(32-2)15-29-23/h4-13,15H,3,14H2,1-2H3 |
| InChIKey | XKMVIGIOQPCHSK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |