C8H24N2Si2 — CID 14115205
1,1-dimethyl-2,2-bis(trimethylsilyl)hydrazine (PubChem CID 14115205) has the molecular formula C8H24N2Si2 and a molecular weight of 204.47 g/mol. Its IUPAC name is 1,1-dimethyl-2,2-bis(trimethylsilyl)hydrazine.
| Compound Name | 1,1-dimethyl-2,2-bis(trimethylsilyl)hydrazine |
|---|---|
| PubChem CID | 14115205 |
| Molecular Formula | C8H24N2Si2 |
| Molecular Weight | 204.47 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1,1-dimethyl-2,2-bis(trimethylsilyl)hydrazine |
| SMILES | CN(C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C8H24N2Si2/c1-9(2)10(11(3,4)5)12(6,7)8/h1-8H3 |
| InChIKey | OYIRKQYQUSPUFV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|