About 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide
4H-pyrimido[1,2-c]pyrimidine-2-carboxamide (PubChem CID 141152251) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide |
| PubChem CID | 141152251 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide |
| SMILES | NC(=O)C1=CCN2C=NC=CC2=N1 |
| InChI | InChI=1S/C8H8N4O/c9-8(13)6-2-4-12-5-10-3-1-7(12)11-6/h1-3,5H,4H2,(H2,9,13) |
| InChIKey | OISZYFAKQHVYPC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide?
The IUPAC name of 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide (CID 141152251) is 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide.
What is the SMILES notation for 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide?
The canonical SMILES for 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide is NC(=O)C1=CCN2C=NC=CC2=N1.
What is the InChIKey of 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide?
The InChIKey is OISZYFAKQHVYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c9-8(13)6-2-4-12-5-10-3-1-7(12)11-6/h1-3,5H,4H2,(H2,9,13).
What are the key properties of 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide?
4H-pyrimido[1,2-c]pyrimidine-2-carboxamide has a molecular weight of 176.18 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrimido[1,2-c]pyrimidine-2-carboxamide is sourced from PubChem (CID 141152251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).