C11H11N3O — CID 141152306
3-(2-phenylethyl)-4H-1,2,4-triazin-5-one (PubChem CID 141152306) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(2-phenylethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2-phenylethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 141152306 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-(2-phenylethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(CCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H11N3O/c15-11-8-12-14-10(13-11)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,13,14,15) |
| InChIKey | WXAQPICVBZTEAK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |