About 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate
6-(oxiran-2-yl)heptyl 2-methylidenebutanoate (PubChem CID 141152818) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate |
| PubChem CID | 141152818 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCCCCCC(C)C1CO1 |
| InChI | InChI=1S/C14H24O3/c1-4-11(2)14(15)16-9-7-5-6-8-12(3)13-10-17-13/h12-13H,2,4-10H2,1,3H3 |
| InChIKey | YJAJWOPJAMWAMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate?
The IUPAC name of 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate (CID 141152818) is 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate.
What is the SMILES notation for 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate?
The canonical SMILES for 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate is C=C(CC)C(=O)OCCCCCC(C)C1CO1.
What is the InChIKey of 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate?
The InChIKey is YJAJWOPJAMWAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-11(2)14(15)16-9-7-5-6-8-12(3)13-10-17-13/h12-13H,2,4-10H2,1,3H3.
What are the key properties of 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate?
6-(oxiran-2-yl)heptyl 2-methylidenebutanoate has a molecular weight of 240.34 g/mol, XLogP of 3.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(oxiran-2-yl)heptyl 2-methylidenebutanoate is sourced from PubChem (CID 141152818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).