About 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine
3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine (PubChem CID 141153254) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine |
| PubChem CID | 141153254 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine |
| SMILES | CC(C1CC1)C(CCN)(CCN)C(C)C1CC1 |
| InChI | InChI=1S/C15H30N2/c1-11(13-3-4-13)15(7-9-16,8-10-17)12(2)14-5-6-14/h11-14H,3-10,16-17H2,1-2H3 |
| InChIKey | HHNPLEQJSOERBT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine?
The IUPAC name of 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine (CID 141153254) is 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine.
What is the SMILES notation for 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine?
The canonical SMILES for 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine is CC(C1CC1)C(CCN)(CCN)C(C)C1CC1.
What is the InChIKey of 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine?
The InChIKey is HHNPLEQJSOERBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-11(13-3-4-13)15(7-9-16,8-10-17)12(2)14-5-6-14/h11-14H,3-10,16-17H2,1-2H3.
What are the key properties of 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine?
3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine has a molecular weight of 238.42 g/mol, XLogP of 2.76, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(1-cyclopropylethyl)pentane-1,5-diamine is sourced from PubChem (CID 141153254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).