C26H36O6 — CID 141153459
1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-4,4-dimethylpentane-1,3-dione (PubChem CID 141153459) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 141153459 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-4,4-dimethylpentane-1,3-dione |
| SMILES | CC(C)(C)C(=O)C(O)C(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H36O6/c1-23(2,3)21(30)20(29)22(31)26(32)11-9-17-16-7-6-14-12-15(27)8-10-24(14,4)19(16)18(28)13-25(17,26)5/h8,10,12,16-20,28-29,32H,6-7,9,11,13H2,1-5H3/t16-,17-,18-,19+,20?,24-,25-,26-/m0/s1 |
| InChIKey | VLGJHRHKDQNZQP-COZNKSMCSA-N |
| XLogP | 2.54 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|