About 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine
3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine (PubChem CID 141153584) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine.
Molecular Properties
| Compound Name | 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine |
| PubChem CID | 141153584 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine |
| SMILES | Cc1cnccc1OCC12COC(C)(OC1)OC2 |
| InChI | InChI=1S/C13H17NO4/c1-10-5-14-4-3-11(10)15-6-13-7-16-12(2,17-8-13)18-9-13/h3-5H,6-9H2,1-2H3 |
| InChIKey | ZFMAUYPKKLASCY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine?
The IUPAC name of 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine (CID 141153584) is 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine.
What is the SMILES notation for 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine?
The canonical SMILES for 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine is Cc1cnccc1OCC12COC(C)(OC1)OC2.
What is the InChIKey of 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine?
The InChIKey is ZFMAUYPKKLASCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-10-5-14-4-3-11(10)15-6-13-7-16-12(2,17-8-13)18-9-13/h3-5H,6-9H2,1-2H3.
What are the key properties of 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine?
3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine has a molecular weight of 251.28 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methoxy]pyridine is sourced from PubChem (CID 141153584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).