C40H36O2 — CID 141153734
6,13-bis(2,4,6-trimethylphenyl)pentacene-6,13-diol (PubChem CID 141153734) has the molecular formula C40H36O2 and a molecular weight of 548.73 g/mol. Its IUPAC name is 6,13-bis(2,4,6-trimethylphenyl)pentacene-6,13-diol.
| Compound Name | 6,13-bis(2,4,6-trimethylphenyl)pentacene-6,13-diol |
|---|---|
| PubChem CID | 141153734 |
| Molecular Formula | C40H36O2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 6,13-bis(2,4,6-trimethylphenyl)pentacene-6,13-diol |
| SMILES | Cc1cc(C)c(C2(O)c3cc4ccccc4cc3C(O)(c3c(C)cc(C)cc3C)c3cc4ccccc4cc32)c(C)c1 |
| InChI | InChI=1S/C40H36O2/c1-23-15-25(3)37(26(4)16-23)39(41)33-19-29-11-7-9-13-31(29)21-35(33)40(42,38-27(5)17-24(2)18-28(38)6)36-22-32-14-10-8-12-30(32)20-34(36)39/h7-22,41-42H,1-6H3 |
| InChIKey | WJAPPZQACFEOEV-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |