C19H21FN4O — CID 141154258
3-ethyl-1-[2-[2-(3-fluorophenyl)pyrazol-3-yl]oxan-4-yl]pyrazole (PubChem CID 141154258) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-ethyl-1-[2-[2-(3-fluorophenyl)pyrazol-3-yl]oxan-4-yl]pyrazole.
| Compound Name | 3-ethyl-1-[2-[2-(3-fluorophenyl)pyrazol-3-yl]oxan-4-yl]pyrazole |
|---|---|
| PubChem CID | 141154258 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-ethyl-1-[2-[2-(3-fluorophenyl)pyrazol-3-yl]oxan-4-yl]pyrazole |
| SMILES | CCc1ccn(C2CCOC(c3ccnn3-c3cccc(F)c3)C2)n1 |
| InChI | InChI=1S/C19H21FN4O/c1-2-15-7-10-23(22-15)16-8-11-25-19(13-16)18-6-9-21-24(18)17-5-3-4-14(20)12-17/h3-7,9-10,12,16,19H,2,8,11,13H2,1H3 |
| InChIKey | HDPWBWBERNDCLT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |